C21H18ClNOS — CID 68540204
1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one (PubChem CID 68540204) has the molecular formula C21H18ClNOS and a molecular weight of 367.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68540204 |
| Molecular Formula | C21H18ClNOS |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(CSC(=Cc2ccc[nH]2)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClNOS/c1-15-4-6-16(7-5-15)14-25-20(13-19-3-2-12-23-19)21(24)17-8-10-18(22)11-9-17/h2-13,23H,14H2,1H3 |
| InChIKey | MBIWCONERHYKHB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|