C22H12ClF5OS — CID 24958555
(E)-1-(4-chlorophenyl)-2-(4-methylphenyl)sulfanyl-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one (PubChem CID 24958555) has the molecular formula C22H12ClF5OS and a molecular weight of 454.85 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-2-(4-methylphenyl)sulfanyl-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-2-(4-methylphenyl)sulfanyl-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24958555 |
| Molecular Formula | C22H12ClF5OS |
| Molecular Weight | 454.85 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-2-(4-methylphenyl)sulfanyl-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(S/C(=C/c2c(F)c(F)c(F)c(F)c2F)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H12ClF5OS/c1-11-2-8-14(9-3-11)30-16(22(29)12-4-6-13(23)7-5-12)10-15-17(24)19(26)21(28)20(27)18(15)25/h2-10H,1H3/b16-10+ |
| InChIKey | FYKBJSZOTFBVRT-MHWRWJLKSA-N |
| XLogP | 7.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.85 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|