C22H15BrCl2OS — CID 68539868
1-(4-bromophenyl)-3-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]prop-2-en-1-one (PubChem CID 68539868) has the molecular formula C22H15BrCl2OS and a molecular weight of 478.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-3-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68539868 |
| Molecular Formula | C22H15BrCl2OS |
| Molecular Weight | 478.24 g/mol |
| Exact Mass | 475.94 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]prop-2-en-1-one |
| SMILES | O=C(C(=Cc1ccc(Cl)cc1)SCc1ccc(Cl)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H15BrCl2OS/c23-18-7-5-17(6-8-18)22(26)21(13-15-1-9-19(24)10-2-15)27-14-16-3-11-20(25)12-4-16/h1-13H,14H2 |
| InChIKey | OIZXAZZTMLYKQE-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.24 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|