C18H26N2O4S — CID 150525384
tert-butyl 2-(methanesulfonamido)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridine-1-carboxylate (PubChem CID 150525384) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is tert-butyl 2-(methanesulfonamido)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 2-(methanesulfonamido)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 150525384 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | tert-butyl 2-(methanesulfonamido)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(NS(C)(=O)=O)CCC2c3ccccc3CC21 |
| InChI | InChI=1S/C18H26N2O4S/c1-18(2,3)24-17(21)20-15-11-12-7-5-6-8-13(12)14(15)9-10-16(20)19-25(4,22)23/h5-8,14-16,19H,9-11H2,1-4H3 |
| InChIKey | ICRXNFYPWFBSKH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |