C25H33N3O3 — CID 168945075
tert-butyl (6aR,9R)-9-(diethylcarbamoyl)-7-(trideuteriomethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate (PubChem CID 168945075) has the molecular formula C25H33N3O3 and a molecular weight of 426.58 g/mol. Its IUPAC name is tert-butyl (6aR,9R)-9-(diethylcarbamoyl)-7-(trideuteriomethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate.
| Compound Name | tert-butyl (6aR,9R)-9-(diethylcarbamoyl)-7-(trideuteriomethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 168945075 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | tert-butyl (6aR,9R)-9-(diethylcarbamoyl)-7-(trideuteriomethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate |
| SMILES | [2H]C([2H])([2H])N1C[C@H](C(=O)N(CC)CC)C=C2c3cccc4c3c(cn4C(=O)OC(C)(C)C)C[C@H]21 |
| InChI | InChI=1S/C25H33N3O3/c1-7-27(8-2)23(29)17-12-19-18-10-9-11-20-22(18)16(13-21(19)26(6)14-17)15-28(20)24(30)31-25(3,4)5/h9-12,15,17,21H,7-8,13-14H2,1-6H3/t17-,21-/m1/s1/i6D3 |
| InChIKey | QZBDHAZNPUPWNX-NUPBXJSPSA-N |
| XLogP | 4.16 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |