C26H37N3O2Si — CID 172872047
N,N-diethyl-7-methyl-4-(3-trimethylsilylpropanoyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 172872047) has the molecular formula C26H37N3O2Si and a molecular weight of 451.69 g/mol. Its IUPAC name is N,N-diethyl-7-methyl-4-(3-trimethylsilylpropanoyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | N,N-diethyl-7-methyl-4-(3-trimethylsilylpropanoyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 172872047 |
| Molecular Formula | C26H37N3O2Si |
| Molecular Weight | 451.69 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | N,N-diethyl-7-methyl-4-(3-trimethylsilylpropanoyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCN(CC)C(=O)C1C=C2c3cccc4c3c(cn4C(=O)CC[Si](C)(C)C)CC2N(C)C1 |
| InChI | InChI=1S/C26H37N3O2Si/c1-7-28(8-2)26(31)19-14-21-20-10-9-11-22-25(20)18(15-23(21)27(3)16-19)17-29(22)24(30)12-13-32(4,5)6/h9-11,14,17,19,23H,7-8,12-13,15-16H2,1-6H3 |
| InChIKey | RYNRSMKGPSUXLC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|