C21H26BN3O — CID 168945046
CID 168945046 (PubChem CID 168945046) has the molecular formula C21H26BN3O and a molecular weight of 347.27 g/mol.
| Compound Name | CID 168945046 |
|---|---|
| PubChem CID | 168945046 |
| Molecular Formula | C21H26BN3O |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | — |
| SMILES | [B]c1c2c3c(cccc3n1C)C1=C[C@@H](C(=O)N(CC)CC)CN(C)C1C2 |
| InChI | InChI=1S/C21H26BN3O/c1-5-25(6-2)21(26)13-10-15-14-8-7-9-17-19(14)16(20(22)24(17)4)11-18(15)23(3)12-13/h7-10,13,18H,5-6,11-12H2,1-4H3/t13-,18?/m1/s1 |
| InChIKey | VEWSQJKEFOHVED-YJJYDOSJSA-N |
| XLogP | 1.71 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|