C25H32BrN3O2 — CID 169001379
(6aR,9R)-5-bromo-N,N-diethyl-7-methyl-4-(3-methylbutanoyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 169001379) has the molecular formula C25H32BrN3O2 and a molecular weight of 486.45 g/mol. Its IUPAC name is (6aR,9R)-5-bromo-N,N-diethyl-7-methyl-4-(3-methylbutanoyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-5-bromo-N,N-diethyl-7-methyl-4-(3-methylbutanoyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 169001379 |
| Molecular Formula | C25H32BrN3O2 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (6aR,9R)-5-bromo-N,N-diethyl-7-methyl-4-(3-methylbutanoyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4c3c(c(Br)n4C(=O)CC(C)C)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C25H32BrN3O2/c1-6-28(7-2)25(31)16-12-18-17-9-8-10-20-23(17)19(13-21(18)27(5)14-16)24(26)29(20)22(30)11-15(3)4/h8-10,12,15-16,21H,6-7,11,13-14H2,1-5H3/t16-,21-/m1/s1 |
| InChIKey | BFXFYBQQWGNQIH-IIBYNOLFSA-N |
| XLogP | 4.83 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |