C30H40BrN3O5 — CID 169001468
[1-(2,2-dimethylpropanoyloxy)-2-methylpropyl] (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate (PubChem CID 169001468) has the molecular formula C30H40BrN3O5 and a molecular weight of 602.57 g/mol. Its IUPAC name is [1-(2,2-dimethylpropanoyloxy)-2-methylpropyl] (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate.
| Compound Name | [1-(2,2-dimethylpropanoyloxy)-2-methylpropyl] (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 169001468 |
| Molecular Formula | C30H40BrN3O5 |
| Molecular Weight | 602.57 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | [1-(2,2-dimethylpropanoyloxy)-2-methylpropyl] (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4c3c(c(Br)n4C(=O)OC(OC(=O)C(C)(C)C)C(C)C)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C30H40BrN3O5/c1-9-33(10-2)26(35)18-14-20-19-12-11-13-22-24(19)21(15-23(20)32(8)16-18)25(31)34(22)29(37)39-27(17(3)4)38-28(36)30(5,6)7/h11-14,17-18,23,27H,9-10,15-16H2,1-8H3/t18-,23-,27?/m1/s1 |
| InChIKey | PJNLRPOQVIQBHY-DLFLQPIISA-N |
| XLogP | 5.70 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|