C26H36BrN5O2 — CID 169001424
5-bromo-4-(2,6-diaminohexanoyl)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 169001424) has the molecular formula C26H36BrN5O2 and a molecular weight of 530.51 g/mol. Its IUPAC name is 5-bromo-4-(2,6-diaminohexanoyl)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | 5-bromo-4-(2,6-diaminohexanoyl)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 169001424 |
| Molecular Formula | C26H36BrN5O2 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 5-bromo-4-(2,6-diaminohexanoyl)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCN(CC)C(=O)C1C=C2c3cccc4c3c(c(Br)n4C(=O)C(N)CCCCN)CC2N(C)C1 |
| InChI | InChI=1S/C26H36BrN5O2/c1-4-31(5-2)25(33)16-13-18-17-9-8-11-21-23(17)19(14-22(18)30(3)15-16)24(27)32(21)26(34)20(29)10-6-7-12-28/h8-9,11,13,16,20,22H,4-7,10,12,14-15,28-29H2,1-3H3 |
| InChIKey | ZZZQZUNPAQXJEL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|