C28H34BrN3O6 — CID 169001480
1-[(3S)-oxolane-3-carbonyl]oxyethyl (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate (PubChem CID 169001480) has the molecular formula C28H34BrN3O6 and a molecular weight of 588.50 g/mol. Its IUPAC name is 1-[(3S)-oxolane-3-carbonyl]oxyethyl (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate.
| Compound Name | 1-[(3S)-oxolane-3-carbonyl]oxyethyl (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 169001480 |
| Molecular Formula | C28H34BrN3O6 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 1-[(3S)-oxolane-3-carbonyl]oxyethyl (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4c3c(c(Br)n4C(=O)OC(C)OC(=O)[C@H]3CCOC3)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C28H34BrN3O6/c1-5-31(6-2)26(33)18-12-20-19-8-7-9-22-24(19)21(13-23(20)30(4)14-18)25(29)32(22)28(35)38-16(3)37-27(34)17-10-11-36-15-17/h7-9,12,16-18,23H,5-6,10-11,13-15H2,1-4H3/t16?,17-,18+,23+/m0/s1 |
| InChIKey | FBPTXRLICNICPM-VMNKYUFESA-N |
| XLogP | 4.05 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|