C28H36BrN3O5 — CID 169001469
1-(2,2-dimethylpropanoyloxy)ethyl (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate (PubChem CID 169001469) has the molecular formula C28H36BrN3O5 and a molecular weight of 574.52 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyloxy)ethyl (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate.
| Compound Name | 1-(2,2-dimethylpropanoyloxy)ethyl (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 169001469 |
| Molecular Formula | C28H36BrN3O5 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 1-(2,2-dimethylpropanoyloxy)ethyl (6aR,9R)-5-bromo-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carboxylate |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4c3c(c(Br)n4C(=O)OC(C)OC(=O)C(C)(C)C)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C28H36BrN3O5/c1-8-31(9-2)25(33)17-13-19-18-11-10-12-21-23(18)20(14-22(19)30(7)15-17)24(29)32(21)27(35)37-16(3)36-26(34)28(4,5)6/h10-13,16-17,22H,8-9,14-15H2,1-7H3/t16?,17-,22-/m1/s1 |
| InChIKey | HDDYQILWHXQXSV-UVMRWNARSA-N |
| XLogP | 5.06 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|