C26H34N2O6 — CID 50900345
(9R,11S)-3,10-bis[(2-methylpropan-2-yl)oxycarbonyl]-9-(2-methylprop-1-enyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxylic acid (PubChem CID 50900345) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is (9R,11S)-3,10-bis[(2-methylpropan-2-yl)oxycarbonyl]-9-(2-methylprop-1-enyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxylic acid.
| Compound Name | (9R,11S)-3,10-bis[(2-methylpropan-2-yl)oxycarbonyl]-9-(2-methylprop-1-enyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 50900345 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | (9R,11S)-3,10-bis[(2-methylpropan-2-yl)oxycarbonyl]-9-(2-methylprop-1-enyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxylic acid |
| SMILES | CC(C)=C[C@@H]1c2cccc3c2c(cn3C(=O)OC(C)(C)C)C[C@@H](C(=O)O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H34N2O6/c1-15(2)12-19-17-10-9-11-18-21(17)16(14-27(18)23(31)33-25(3,4)5)13-20(22(29)30)28(19)24(32)34-26(6,7)8/h9-12,14,19-20H,13H2,1-8H3,(H,29,30)/t19-,20+/m1/s1 |
| InChIKey | GZGOTUGCZUBKBV-UXHICEINSA-N |
| XLogP | 5.68 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|