C27H36N2O6 — CID 59052066
2-O,9-O-ditert-butyl 3-O-methyl (1S,3S)-1-(2-methylprop-1-enyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2,3,9-tricarboxylate (PubChem CID 59052066) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is 2-O,9-O-ditert-butyl 3-O-methyl (1S,3S)-1-(2-methylprop-1-enyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2,3,9-tricarboxylate.
| Compound Name | 2-O,9-O-ditert-butyl 3-O-methyl (1S,3S)-1-(2-methylprop-1-enyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2,3,9-tricarboxylate |
|---|---|
| PubChem CID | 59052066 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2-O,9-O-ditert-butyl 3-O-methyl (1S,3S)-1-(2-methylprop-1-enyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2,3,9-tricarboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c(n(C(=O)OC(C)(C)C)c3ccccc23)[C@H](C=C(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H36N2O6/c1-16(2)14-20-22-18(15-21(23(30)33-9)28(20)24(31)34-26(3,4)5)17-12-10-11-13-19(17)29(22)25(32)35-27(6,7)8/h10-14,20-21H,15H2,1-9H3/t20-,21-/m0/s1 |
| InChIKey | VZYZMHLETKZGIL-SFTDATJTSA-N |
| XLogP | 5.77 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|