C28H34N2O4 — CID 102493595
tert-butyl (5S,6R)-6-ethyl-5-hydroxy-4-oxo-3-[(1S)-1-phenylethyl]-1,2,5,6-tetrahydroazocino[5,4-b]indole-7-carboxylate (PubChem CID 102493595) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is tert-butyl (5S,6R)-6-ethyl-5-hydroxy-4-oxo-3-[(1S)-1-phenylethyl]-1,2,5,6-tetrahydroazocino[5,4-b]indole-7-carboxylate.
| Compound Name | tert-butyl (5S,6R)-6-ethyl-5-hydroxy-4-oxo-3-[(1S)-1-phenylethyl]-1,2,5,6-tetrahydroazocino[5,4-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 102493595 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | tert-butyl (5S,6R)-6-ethyl-5-hydroxy-4-oxo-3-[(1S)-1-phenylethyl]-1,2,5,6-tetrahydroazocino[5,4-b]indole-7-carboxylate |
| SMILES | CC[C@@H]1c2c(c3ccccc3n2C(=O)OC(C)(C)C)CCN([C@@H](C)c2ccccc2)C(=O)[C@H]1O |
| InChI | InChI=1S/C28H34N2O4/c1-6-20-24-22(21-14-10-11-15-23(21)30(24)27(33)34-28(3,4)5)16-17-29(26(32)25(20)31)18(2)19-12-8-7-9-13-19/h7-15,18,20,25,31H,6,16-17H2,1-5H3/t18-,20+,25-/m0/s1 |
| InChIKey | LZZNADGUQMISAO-NNPDTBDGSA-N |
| XLogP | 5.42 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |