C21H24N2O4 — CID 11537930
tert-butyl (6R,12bS)-6-formyl-4-oxo-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizine-12-carboxylate (PubChem CID 11537930) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is tert-butyl (6R,12bS)-6-formyl-4-oxo-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizine-12-carboxylate.
| Compound Name | tert-butyl (6R,12bS)-6-formyl-4-oxo-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizine-12-carboxylate |
|---|---|
| PubChem CID | 11537930 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | tert-butyl (6R,12bS)-6-formyl-4-oxo-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizine-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ccccc31)C[C@H](C=O)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C21H24N2O4/c1-21(2,3)27-20(26)23-16-8-5-4-7-14(16)15-11-13(12-24)22-17(19(15)23)9-6-10-18(22)25/h4-5,7-8,12-13,17H,6,9-11H2,1-3H3/t13-,17+/m1/s1 |
| InChIKey | FEURIUACAZQEPN-DYVFJYSZSA-N |
| XLogP | 3.60 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|