C25H37N2O2+ — CID 15102329
tert-butyl (2S,5R,12bS)-2-tert-butyl-5-methyl-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-5-ium-12-carboxylate (PubChem CID 15102329) has the molecular formula C25H37N2O2+ and a molecular weight of 397.58 g/mol. Its IUPAC name is tert-butyl (2S,5R,12bS)-2-tert-butyl-5-methyl-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-5-ium-12-carboxylate.
| Compound Name | tert-butyl (2S,5R,12bS)-2-tert-butyl-5-methyl-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-5-ium-12-carboxylate |
|---|---|
| PubChem CID | 15102329 |
| Molecular Formula | C25H37N2O2+ |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | tert-butyl (2S,5R,12bS)-2-tert-butyl-5-methyl-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-5-ium-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ccccc31)CC[N@@+]1(C)CC[C@H](C(C)(C)C)C[C@@H]21 |
| InChI | InChI=1S/C25H37N2O2/c1-24(2,3)17-12-14-27(7)15-13-19-18-10-8-9-11-20(18)26(22(19)21(27)16-17)23(28)29-25(4,5)6/h8-11,17,21H,12-16H2,1-7H3/q+1/t17-,21-,27+/m0/s1 |
| InChIKey | URGSZUHHJWMIME-SJQPRBQBSA-N |
| XLogP | 5.92 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|