C32H45N2O7S+ — CID 56946779
11-O-tert-butyl 3-O-methyl (11bS)-3-ethylsulfanyl-4-[(E)-4-[(2-methylpropan-2-yl)oxycarbonyloxy]but-2-enyl]-2,5,6,11b-tetrahydro-1H-indolizino[8,7-b]indol-4-ium-3,11-dicarboxylate (PubChem CID 56946779) has the molecular formula C32H45N2O7S+ and a molecular weight of 601.79 g/mol. Its IUPAC name is 11-O-tert-butyl 3-O-methyl (11bS)-3-ethylsulfanyl-4-[(E)-4-[(2-methylpropan-2-yl)oxycarbonyloxy]but-2-enyl]-2,5,6,11b-tetrahydro-1H-indolizino[8,7-b]indol-4-ium-3,11-dicarboxylate.
| Compound Name | 11-O-tert-butyl 3-O-methyl (11bS)-3-ethylsulfanyl-4-[(E)-4-[(2-methylpropan-2-yl)oxycarbonyloxy]but-2-enyl]-2,5,6,11b-tetrahydro-1H-indolizino[8,7-b]indol-4-ium-3,11-dicarboxylate |
|---|---|
| PubChem CID | 56946779 |
| Molecular Formula | C32H45N2O7S+ |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | 11-O-tert-butyl 3-O-methyl (11bS)-3-ethylsulfanyl-4-[(E)-4-[(2-methylpropan-2-yl)oxycarbonyloxy]but-2-enyl]-2,5,6,11b-tetrahydro-1H-indolizino[8,7-b]indol-4-ium-3,11-dicarboxylate |
| SMILES | CCSC1(C(=O)OC)CC[C@H]2c3c(c4ccccc4n3C(=O)OC(C)(C)C)CC[N+]21C/C=C/COC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H45N2O7S/c1-9-42-32(27(35)38-8)18-16-25-26-23(22-14-10-11-15-24(22)33(26)28(36)40-30(2,3)4)17-20-34(25,32)19-12-13-21-39-29(37)41-31(5,6)7/h10-15,25H,9,16-21H2,1-8H3/q+1/b13-12+/t25-,32?,34?/m0/s1 |
| InChIKey | BEURDJWIJMITDJ-VCRXRRCDSA-N |
| XLogP | 6.76 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|