C29H42N2O8 — CID 101179339
ditert-butyl 5-[2-(dimethoxymethyl)-3-methoxy-3-oxopropyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3,6-dicarboxylate (PubChem CID 101179339) has the molecular formula C29H42N2O8 and a molecular weight of 546.66 g/mol. Its IUPAC name is ditert-butyl 5-[2-(dimethoxymethyl)-3-methoxy-3-oxopropyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3,6-dicarboxylate.
| Compound Name | ditert-butyl 5-[2-(dimethoxymethyl)-3-methoxy-3-oxopropyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3,6-dicarboxylate |
|---|---|
| PubChem CID | 101179339 |
| Molecular Formula | C29H42N2O8 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | ditert-butyl 5-[2-(dimethoxymethyl)-3-methoxy-3-oxopropyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3,6-dicarboxylate |
| SMILES | COC(=O)C(CC1CN(C(=O)OC(C)(C)C)CCc2c1n(C(=O)OC(C)(C)C)c1ccccc21)C(OC)OC |
| InChI | InChI=1S/C29H42N2O8/c1-28(2,3)38-26(33)30-15-14-20-19-12-10-11-13-22(19)31(27(34)39-29(4,5)6)23(20)18(17-30)16-21(24(32)35-7)25(36-8)37-9/h10-13,18,21,25H,14-17H2,1-9H3 |
| InChIKey | PLIHPINAPZTXFS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 105.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|