C24H30N2O3 — CID 45103025
tert-butyl (1S,14S,19R)-18-oxo-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8-tetraene-3-carboxylate (PubChem CID 45103025) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is tert-butyl (1S,14S,19R)-18-oxo-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8-tetraene-3-carboxylate.
| Compound Name | tert-butyl (1S,14S,19R)-18-oxo-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 45103025 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | tert-butyl (1S,14S,19R)-18-oxo-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8-tetraene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ccccc31)CCN1[C@H]2CC[C@H]2C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C24H30N2O3/c1-24(2,3)29-23(28)26-19-8-5-4-7-15(19)16-13-14-25-18-9-6-10-21(27)17(18)11-12-20(25)22(16)26/h4-5,7-8,17-18,20H,6,9-14H2,1-3H3/t17-,18+,20+/m1/s1 |
| InChIKey | ZDANYYLAPWPHDG-HBFSDRIKSA-N |
| XLogP | 4.86 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |