C23H31N3O3 — CID 25212916
tert-butyl (3R,6S,12bS)-3-ethyl-6-[(E)-hydroxyiminomethyl]-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine-12-carboxylate (PubChem CID 25212916) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl (3R,6S,12bS)-3-ethyl-6-[(E)-hydroxyiminomethyl]-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine-12-carboxylate.
| Compound Name | tert-butyl (3R,6S,12bS)-3-ethyl-6-[(E)-hydroxyiminomethyl]-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine-12-carboxylate |
|---|---|
| PubChem CID | 25212916 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | tert-butyl (3R,6S,12bS)-3-ethyl-6-[(E)-hydroxyiminomethyl]-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine-12-carboxylate |
| SMILES | CC[C@@H]1CC[C@H]2c3c(c4ccccc4n3C(=O)OC(C)(C)C)C[C@@H](/C=N/O)N2C1 |
| InChI | InChI=1S/C23H31N3O3/c1-5-15-10-11-20-21-18(12-16(13-24-28)25(20)14-15)17-8-6-7-9-19(17)26(21)22(27)29-23(2,3)4/h6-9,13,15-16,20,28H,5,10-12,14H2,1-4H3/b24-13+/t15-,16+,20+/m1/s1 |
| InChIKey | VKZRFFLLYJHVOY-ARABAAQBSA-N |
| XLogP | 4.97 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|