C27H28N2O4Se — CID 11306984
tert-butyl (6S,12bR)-4-oxo-6-phenylselanylcarbonyl-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizine-12-carboxylate (PubChem CID 11306984) has the molecular formula C27H28N2O4Se and a molecular weight of 523.49 g/mol. Its IUPAC name is tert-butyl (6S,12bR)-4-oxo-6-phenylselanylcarbonyl-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizine-12-carboxylate.
| Compound Name | tert-butyl (6S,12bR)-4-oxo-6-phenylselanylcarbonyl-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizine-12-carboxylate |
|---|---|
| PubChem CID | 11306984 |
| Molecular Formula | C27H28N2O4Se |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | tert-butyl (6S,12bR)-4-oxo-6-phenylselanylcarbonyl-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizine-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ccccc31)C[C@@H](C(=O)[Se]c1ccccc1)N1C(=O)CCC[C@H]21 |
| InChI | InChI=1S/C27H28N2O4Se/c1-27(2,3)33-26(32)29-20-13-8-7-12-18(20)19-16-22(25(31)34-17-10-5-4-6-11-17)28-21(24(19)29)14-9-15-23(28)30/h4-8,10-13,21-22H,9,14-16H2,1-3H3/t21-,22+/m1/s1 |
| InChIKey | NLNRYNGSCBOZAX-YADHBBJMSA-N |
| XLogP | 3.96 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|