C17H21NO2 — CID 175334508
1-tert-butyl-1,2,3,4-tetrahydrocarbazole-9-carboxylic acid (PubChem CID 175334508) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-tert-butyl-1,2,3,4-tetrahydrocarbazole-9-carboxylic acid.
| Compound Name | 1-tert-butyl-1,2,3,4-tetrahydrocarbazole-9-carboxylic acid |
|---|---|
| PubChem CID | 175334508 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-tert-butyl-1,2,3,4-tetrahydrocarbazole-9-carboxylic acid |
| SMILES | CC(C)(C)C1CCCc2c1n(C(=O)O)c1ccccc21 |
| InChI | InChI=1S/C17H21NO2/c1-17(2,3)13-9-6-8-12-11-7-4-5-10-14(11)18(15(12)13)16(19)20/h4-5,7,10,13H,6,8-9H2,1-3H3,(H,19,20) |
| InChIKey | DQZYPIQTBCBIES-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |