C16H12F6N2O2 — CID 102061055
2,2,2-trifluoro-1-[1-methyl-9-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]ethanone (PubChem CID 102061055) has the molecular formula C16H12F6N2O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-methyl-9-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1-methyl-9-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 102061055 |
| Molecular Formula | C16H12F6N2O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-methyl-9-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]ethanone |
| SMILES | CC1c2c(c3ccccc3n2C(=O)C(F)(F)F)CCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H12F6N2O2/c1-8-12-10(6-7-23(8)13(25)15(17,18)19)9-4-2-3-5-11(9)24(12)14(26)16(20,21)22/h2-5,8H,6-7H2,1H3 |
| InChIKey | QTWGKZVCECRZAV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |