C18H23NO2 — CID 102311230
tert-butyl 1-methyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate (PubChem CID 102311230) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl 1-methyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate.
| Compound Name | tert-butyl 1-methyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 102311230 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | tert-butyl 1-methyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate |
| SMILES | CC1CCCc2c1n(C(=O)OC(C)(C)C)c1ccccc21 |
| InChI | InChI=1S/C18H23NO2/c1-12-8-7-10-14-13-9-5-6-11-15(13)19(16(12)14)17(20)21-18(2,3)4/h5-6,9,11-12H,7-8,10H2,1-4H3 |
| InChIKey | PQAANCSNVRDSHH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |