C29H45NO3Si — CID 102202920
tert-butyl 6,9-dimethyl-8-tri(propan-2-yl)silyloxy-7,10-dihydro-6H-cyclohepta[b]indole-5-carboxylate (PubChem CID 102202920) has the molecular formula C29H45NO3Si and a molecular weight of 483.77 g/mol. Its IUPAC name is tert-butyl 6,9-dimethyl-8-tri(propan-2-yl)silyloxy-7,10-dihydro-6H-cyclohepta[b]indole-5-carboxylate.
| Compound Name | tert-butyl 6,9-dimethyl-8-tri(propan-2-yl)silyloxy-7,10-dihydro-6H-cyclohepta[b]indole-5-carboxylate |
|---|---|
| PubChem CID | 102202920 |
| Molecular Formula | C29H45NO3Si |
| Molecular Weight | 483.77 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | tert-butyl 6,9-dimethyl-8-tri(propan-2-yl)silyloxy-7,10-dihydro-6H-cyclohepta[b]indole-5-carboxylate |
| SMILES | CC1=C(O[Si](C(C)C)(C(C)C)C(C)C)CC(C)c2c(c3ccccc3n2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C29H45NO3Si/c1-18(2)34(19(3)4,20(5)6)33-26-17-22(8)27-24(16-21(26)7)23-14-12-13-15-25(23)30(27)28(31)32-29(9,10)11/h12-15,18-20,22H,16-17H2,1-11H3 |
| InChIKey | PHOVOUMXOOLKHV-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.77 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|