C23H24N2 — CID 23391962
1,9-dimethyl-2-[(3E)-4-phenylbuta-1,3-dien-2-yl]-3,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 23391962) has the molecular formula C23H24N2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1,9-dimethyl-2-[(3E)-4-phenylbuta-1,3-dien-2-yl]-3,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1,9-dimethyl-2-[(3E)-4-phenylbuta-1,3-dien-2-yl]-3,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 23391962 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1,9-dimethyl-2-[(3E)-4-phenylbuta-1,3-dien-2-yl]-3,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | C=C(/C=C/c1ccccc1)N1CCc2c(n(C)c3ccccc23)C1C |
| InChI | InChI=1S/C23H24N2/c1-17(13-14-19-9-5-4-6-10-19)25-16-15-21-20-11-7-8-12-22(20)24(3)23(21)18(25)2/h4-14,18H,1,15-16H2,2-3H3/b14-13+ |
| InChIKey | IMRPXYIQDSQLPG-BUHFOSPRSA-N |
| XLogP | 5.32 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|