C14H15N3O — CID 72724645
16-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-5-one (PubChem CID 72724645) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 16-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-5-one.
| Compound Name | 16-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-5-one |
|---|---|
| PubChem CID | 72724645 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 16-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-5-one |
| SMILES | Cn1c2c(c3ccccc31)CCN1C(=O)NCC21 |
| InChI | InChI=1S/C14H15N3O/c1-16-11-5-3-2-4-9(11)10-6-7-17-12(13(10)16)8-15-14(17)18/h2-5,12H,6-8H2,1H3,(H,15,18) |
| InChIKey | FCRNNYLOBRVGIB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|