C11H12N2 — CID 82411813
4-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 82411813) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | 4-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 82411813 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | Cn1c2c(c3ccccc31)CCN2 |
| InChI | InChI=1S/C11H12N2/c1-13-10-5-3-2-4-8(10)9-6-7-12-11(9)13/h2-5,12H,6-7H2,1H3 |
| InChIKey | WQFKAPNROMHWPQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |