C14H16N2 — CID 132918732
(5Z)-7-methyl-1,2,3,4-tetrahydroazocino[5,4-b]indole (PubChem CID 132918732) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (5Z)-7-methyl-1,2,3,4-tetrahydroazocino[5,4-b]indole.
| Compound Name | (5Z)-7-methyl-1,2,3,4-tetrahydroazocino[5,4-b]indole |
|---|---|
| PubChem CID | 132918732 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (5Z)-7-methyl-1,2,3,4-tetrahydroazocino[5,4-b]indole |
| SMILES | Cn1c2c(c3ccccc31)CCNC/C=C\2 |
| InChI | InChI=1S/C14H16N2/c1-16-13-6-3-2-5-11(13)12-8-10-15-9-4-7-14(12)16/h2-7,15H,8-10H2,1H3/b7-4- |
| InChIKey | XREGKZAMXVJWLI-DAXSKMNVSA-N |
| XLogP | 2.34 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |