C15H19N3O — CID 90835395
9-[2-(dimethylamino)ethyl]-3,4-dihydro-2H-pyrido[3,4-b]indol-1-one (PubChem CID 90835395) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 9-[2-(dimethylamino)ethyl]-3,4-dihydro-2H-pyrido[3,4-b]indol-1-one.
| Compound Name | 9-[2-(dimethylamino)ethyl]-3,4-dihydro-2H-pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 90835395 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 9-[2-(dimethylamino)ethyl]-3,4-dihydro-2H-pyrido[3,4-b]indol-1-one |
| SMILES | CN(C)CCn1c2c(c3ccccc31)CCNC2=O |
| InChI | InChI=1S/C15H19N3O/c1-17(2)9-10-18-13-6-4-3-5-11(13)12-7-8-16-15(19)14(12)18/h3-6H,7-10H2,1-2H3,(H,16,19) |
| InChIKey | WAKJNQFTSRMXOD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|