C16H21N3O — CID 97356822
4-[3-(dimethylamino)propyl]-2-methyl-1H-pyrrolo[3,4-b]indol-3-one (PubChem CID 97356822) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propyl]-2-methyl-1H-pyrrolo[3,4-b]indol-3-one.
| Compound Name | 4-[3-(dimethylamino)propyl]-2-methyl-1H-pyrrolo[3,4-b]indol-3-one |
|---|---|
| PubChem CID | 97356822 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-[3-(dimethylamino)propyl]-2-methyl-1H-pyrrolo[3,4-b]indol-3-one |
| SMILES | CN(C)CCCn1c2c(c3ccccc31)CN(C)C2=O |
| InChI | InChI=1S/C16H21N3O/c1-17(2)9-6-10-19-14-8-5-4-7-12(14)13-11-18(3)16(20)15(13)19/h4-5,7-8H,6,9-11H2,1-3H3 |
| InChIKey | QZTQQAVCEWURRJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|