C18H24ClN3O — CID 91218501
9-[3-(butylamino)propyl]-6-chloro-3,4-dihydro-2H-pyrido[3,4-b]indol-1-one (PubChem CID 91218501) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 9-[3-(butylamino)propyl]-6-chloro-3,4-dihydro-2H-pyrido[3,4-b]indol-1-one.
| Compound Name | 9-[3-(butylamino)propyl]-6-chloro-3,4-dihydro-2H-pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 91218501 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 9-[3-(butylamino)propyl]-6-chloro-3,4-dihydro-2H-pyrido[3,4-b]indol-1-one |
| SMILES | CCCCNCCCn1c2c(c3cc(Cl)ccc31)CCNC2=O |
| InChI | InChI=1S/C18H24ClN3O/c1-2-3-8-20-9-4-11-22-16-6-5-13(19)12-15(16)14-7-10-21-18(23)17(14)22/h5-6,12,20H,2-4,7-11H2,1H3,(H,21,23) |
| InChIKey | HKOCSXGTVHMLLU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|