C18H24ClNO — CID 100994473
(2R)-1-(6-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)hexan-2-ol (PubChem CID 100994473) has the molecular formula C18H24ClNO and a molecular weight of 305.85 g/mol. Its IUPAC name is (2R)-1-(6-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)hexan-2-ol.
| Compound Name | (2R)-1-(6-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)hexan-2-ol |
|---|---|
| PubChem CID | 100994473 |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (2R)-1-(6-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)hexan-2-ol |
| SMILES | CCCC[C@@H](O)Cn1c2c(c3cc(Cl)ccc31)CCCC2 |
| InChI | InChI=1S/C18H24ClNO/c1-2-3-6-14(21)12-20-17-8-5-4-7-15(17)16-11-13(19)9-10-18(16)20/h9-11,14,21H,2-8,12H2,1H3/t14-/m1/s1 |
| InChIKey | CZUQBFZOMZSQCJ-CQSZACIVSA-N |
| XLogP | 4.72 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|