C28H26N2S — CID 122205076
(13E)-3,24-dimethyl-29-thia-3,24-diazahexacyclo[24.2.1.02,10.04,9.017,25.018,23]nonacosa-1(28),2(10),4,6,8,13,17(25),18,20,22,26-undecaene (PubChem CID 122205076) has the molecular formula C28H26N2S and a molecular weight of 422.60 g/mol. Its IUPAC name is (13E)-3,24-dimethyl-29-thia-3,24-diazahexacyclo[24.2.1.02,10.04,9.017,25.018,23]nonacosa-1(28),2(10),4,6,8,13,17(25),18,20,22,26-undecaene.
| Compound Name | (13E)-3,24-dimethyl-29-thia-3,24-diazahexacyclo[24.2.1.02,10.04,9.017,25.018,23]nonacosa-1(28),2(10),4,6,8,13,17(25),18,20,22,26-undecaene |
|---|---|
| PubChem CID | 122205076 |
| Molecular Formula | C28H26N2S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (13E)-3,24-dimethyl-29-thia-3,24-diazahexacyclo[24.2.1.02,10.04,9.017,25.018,23]nonacosa-1(28),2(10),4,6,8,13,17(25),18,20,22,26-undecaene |
| SMILES | Cn1c2c(c3ccccc31)CC/C=C/CCc1c(n(C)c3ccccc13)-c1ccc-2s1 |
| InChI | InChI=1S/C28H26N2S/c1-29-23-15-9-7-11-19(23)21-13-5-3-4-6-14-22-20-12-8-10-16-24(20)30(2)28(22)26-18-17-25(31-26)27(21)29/h3-4,7-12,15-18H,5-6,13-14H2,1-2H3/b4-3+ |
| InChIKey | UEXJNZMWTFONNC-ONEGZZNKSA-N |
| XLogP | 7.50 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|