C29H27N3 — CID 177470984
(13E)-3,24-dimethyl-3,24,30-triazahexacyclo[24.3.1.02,10.04,9.017,25.018,23]triaconta-1(30),2(10),4,6,8,13,17(25),18,20,22,26,28-dodecaene (PubChem CID 177470984) has the molecular formula C29H27N3 and a molecular weight of 417.56 g/mol. Its IUPAC name is (13E)-3,24-dimethyl-3,24,30-triazahexacyclo[24.3.1.02,10.04,9.017,25.018,23]triaconta-1(30),2(10),4,6,8,13,17(25),18,20,22,26,28-dodecaene.
| Compound Name | (13E)-3,24-dimethyl-3,24,30-triazahexacyclo[24.3.1.02,10.04,9.017,25.018,23]triaconta-1(30),2(10),4,6,8,13,17(25),18,20,22,26,28-dodecaene |
|---|---|
| PubChem CID | 177470984 |
| Molecular Formula | C29H27N3 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (13E)-3,24-dimethyl-3,24,30-triazahexacyclo[24.3.1.02,10.04,9.017,25.018,23]triaconta-1(30),2(10),4,6,8,13,17(25),18,20,22,26,28-dodecaene |
| SMILES | Cn1c2c(c3ccccc31)CC/C=C\CCc1c(n(C)c3ccccc13)-c1cccc-2n1 |
| InChI | InChI=1S/C29H27N3/c1-31-26-18-9-7-12-20(26)22-14-5-3-4-6-15-23-21-13-8-10-19-27(21)32(2)29(23)25-17-11-16-24(30-25)28(22)31/h3-4,7-13,16-19H,5-6,14-15H2,1-2H3/b4-3- |
| InChIKey | YWKNOAVYSOICBT-ARJAWSKDSA-N |
| XLogP | 6.83 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|