C16H15N3O — CID 71148065
3,17-dimethyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,5,11,13,15-hexaen-4-one (PubChem CID 71148065) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 3,17-dimethyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,5,11,13,15-hexaen-4-one.
| Compound Name | 3,17-dimethyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,5,11,13,15-hexaen-4-one |
|---|---|
| PubChem CID | 71148065 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3,17-dimethyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,5,11,13,15-hexaen-4-one |
| SMILES | Cc1c2n(cnc1=O)CCc1c-2n(C)c2ccccc12 |
| InChI | InChI=1S/C16H15N3O/c1-10-14-15-12(7-8-19(14)9-17-16(10)20)11-5-3-4-6-13(11)18(15)2/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | IHDUKQHXMXEXSH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|