C11H11N3 — CID 151226131
9-methyl-1,2-dihydropyrimido[4,5-b]indole (PubChem CID 151226131) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 9-methyl-1,2-dihydropyrimido[4,5-b]indole.
| Compound Name | 9-methyl-1,2-dihydropyrimido[4,5-b]indole |
|---|---|
| PubChem CID | 151226131 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 9-methyl-1,2-dihydropyrimido[4,5-b]indole |
| SMILES | Cn1c2c(c3ccccc31)C=NCN2 |
| InChI | InChI=1S/C11H11N3/c1-14-10-5-3-2-4-8(10)9-6-12-7-13-11(9)14/h2-6,13H,7H2,1H3 |
| InChIKey | VLBPUIGWWAHHRI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |