C18H15N — CID 145265092
18-methyl-18-azatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2,4,6,9,12,14,16-octaene (PubChem CID 145265092) has the molecular formula C18H15N and a molecular weight of 245.33 g/mol. Its IUPAC name is 18-methyl-18-azatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2,4,6,9,12,14,16-octaene.
| Compound Name | 18-methyl-18-azatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2,4,6,9,12,14,16-octaene |
|---|---|
| PubChem CID | 145265092 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 18-methyl-18-azatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2,4,6,9,12,14,16-octaene |
| SMILES | Cn1c2c(c3ccccc31)C=CCc1ccccc1-2 |
| InChI | InChI=1S/C18H15N/c1-19-17-12-5-4-10-15(17)16-11-6-8-13-7-2-3-9-14(13)18(16)19/h2-7,9-12H,8H2,1H3 |
| InChIKey | KYOMTBOZDQMEKB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |