About 9-methyl-2H-thiopyrano[2,3-b]indole
9-methyl-2H-thiopyrano[2,3-b]indole (PubChem CID 175258385) has the molecular formula C12H11NS
and a molecular weight of 201.29 g/mol. Its IUPAC name is 9-methyl-2H-thiopyrano[2,3-b]indole.
Molecular Properties
| Compound Name | 9-methyl-2H-thiopyrano[2,3-b]indole |
| PubChem CID | 175258385 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 9-methyl-2H-thiopyrano[2,3-b]indole |
| SMILES | Cn1c2c(c3ccccc31)C=CCS2 |
| InChI | InChI=1S/C12H11NS/c1-13-11-7-3-2-5-9(11)10-6-4-8-14-12(10)13/h2-7H,8H2,1H3 |
| InChIKey | MOWZHUMYCSNJBI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-methyl-2H-thiopyrano[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-2H-thiopyrano[2,3-b]indole?
The IUPAC name of 9-methyl-2H-thiopyrano[2,3-b]indole (CID 175258385) is 9-methyl-2H-thiopyrano[2,3-b]indole.
What is the SMILES notation for 9-methyl-2H-thiopyrano[2,3-b]indole?
The canonical SMILES for 9-methyl-2H-thiopyrano[2,3-b]indole is Cn1c2c(c3ccccc31)C=CCS2.
What is the InChIKey of 9-methyl-2H-thiopyrano[2,3-b]indole?
The InChIKey is MOWZHUMYCSNJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NS/c1-13-11-7-3-2-5-9(11)10-6-4-8-14-12(10)13/h2-7H,8H2,1H3.
What are the key properties of 9-methyl-2H-thiopyrano[2,3-b]indole?
9-methyl-2H-thiopyrano[2,3-b]indole has a molecular weight of 201.29 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-2H-thiopyrano[2,3-b]indole is sourced from PubChem (CID 175258385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).