C12H11NS — CID 175258385
9-methyl-2H-thiopyrano[2,3-b]indole (PubChem CID 175258385) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 9-methyl-2H-thiopyrano[2,3-b]indole.
| Compound Name | 9-methyl-2H-thiopyrano[2,3-b]indole |
|---|---|
| PubChem CID | 175258385 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 9-methyl-2H-thiopyrano[2,3-b]indole |
| SMILES | Cn1c2c(c3ccccc31)C=CCS2 |
| InChI | InChI=1S/C12H11NS/c1-13-11-7-3-2-5-9(11)10-6-4-8-14-12(10)13/h2-7H,8H2,1H3 |
| InChIKey | MOWZHUMYCSNJBI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |