About 9H-carbazole;9-methylcarbazole
9H-carbazole;9-methylcarbazole (PubChem CID 142567226) has the molecular formula C25H20N2
and a molecular weight of 348.45 g/mol. Its IUPAC name is 9H-carbazole;9-methylcarbazole.
Molecular Properties
| Compound Name | 9H-carbazole;9-methylcarbazole |
| PubChem CID | 142567226 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 9H-carbazole;9-methylcarbazole |
| SMILES | Cn1c2ccccc2c2ccccc21.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C13H11N.C12H9N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h2-9H,1H3;1-8,13H |
| InChIKey | MUOINLWLBFCXAB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-carbazole;9-methylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;9-methylcarbazole?
The IUPAC name of 9H-carbazole;9-methylcarbazole (CID 142567226) is 9H-carbazole;9-methylcarbazole.
What is the SMILES notation for 9H-carbazole;9-methylcarbazole?
The canonical SMILES for 9H-carbazole;9-methylcarbazole is Cn1c2ccccc2c2ccccc21.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;9-methylcarbazole?
The InChIKey is MUOINLWLBFCXAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N.C12H9N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h2-9H,1H3;1-8,13H.
What are the key properties of 9H-carbazole;9-methylcarbazole?
9H-carbazole;9-methylcarbazole has a molecular weight of 348.45 g/mol, XLogP of 6.65, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;9-methylcarbazole is sourced from PubChem (CID 142567226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).