About lithium;hydride;4-(2-methylphenyl)-1H-indene
lithium;hydride;4-(2-methylphenyl)-1H-indene (PubChem CID 175034488) has the molecular formula C16H15Li
and a molecular weight of 214.24 g/mol. Its IUPAC name is lithium;hydride;4-(2-methylphenyl)-1H-indene.
Molecular Properties
| Compound Name | lithium;hydride;4-(2-methylphenyl)-1H-indene |
| PubChem CID | 175034488 |
| Molecular Formula | C16H15Li |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | lithium;hydride;4-(2-methylphenyl)-1H-indene |
| SMILES | Cc1ccccc1-c1cccc2c1C=CC2.[H-].[Li+] |
| InChI | InChI=1S/C16H14.Li.H/c1-12-6-2-3-9-14(12)16-11-5-8-13-7-4-10-15(13)16;;/h2-6,8-11H,7H2,1H3;;/q;+1;-1 |
| InChIKey | QGWAAVZUJIVXKE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium;hydride;4-(2-methylphenyl)-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;4-(2-methylphenyl)-1H-indene?
The IUPAC name of lithium;hydride;4-(2-methylphenyl)-1H-indene (CID 175034488) is lithium;hydride;4-(2-methylphenyl)-1H-indene.
What is the SMILES notation for lithium;hydride;4-(2-methylphenyl)-1H-indene?
The canonical SMILES for lithium;hydride;4-(2-methylphenyl)-1H-indene is Cc1ccccc1-c1cccc2c1C=CC2.[H-].[Li+].
What is the InChIKey of lithium;hydride;4-(2-methylphenyl)-1H-indene?
The InChIKey is QGWAAVZUJIVXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14.Li.H/c1-12-6-2-3-9-14(12)16-11-5-8-13-7-4-10-15(13)16;;/h2-6,8-11H,7H2,1H3;;/q;+1;-1.
What are the key properties of lithium;hydride;4-(2-methylphenyl)-1H-indene?
lithium;hydride;4-(2-methylphenyl)-1H-indene has a molecular weight of 214.24 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;4-(2-methylphenyl)-1H-indene is sourced from PubChem (CID 175034488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).