About 4-propyl-1H-indene
4-propyl-1H-indene (PubChem CID 18314956) has the molecular formula C12H14
and a molecular weight of 158.24 g/mol. Its IUPAC name is 4-propyl-1H-indene.
Molecular Properties
| Compound Name | 4-propyl-1H-indene |
| PubChem CID | 18314956 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 4-propyl-1H-indene |
| SMILES | CCCc1cccc2c1C=CC2 |
| InChI | InChI=1S/C12H14/c1-2-5-10-6-3-7-11-8-4-9-12(10)11/h3-4,6-7,9H,2,5,8H2,1H3 |
| InChIKey | LVJAUONRUZXBPH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-propyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-1H-indene?
The IUPAC name of 4-propyl-1H-indene (CID 18314956) is 4-propyl-1H-indene.
What is the SMILES notation for 4-propyl-1H-indene?
The canonical SMILES for 4-propyl-1H-indene is CCCc1cccc2c1C=CC2.
What is the InChIKey of 4-propyl-1H-indene?
The InChIKey is LVJAUONRUZXBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14/c1-2-5-10-6-3-7-11-8-4-9-12(10)11/h3-4,6-7,9H,2,5,8H2,1H3.
What are the key properties of 4-propyl-1H-indene?
4-propyl-1H-indene has a molecular weight of 158.24 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-1H-indene is sourced from PubChem (CID 18314956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).