C12H15N — CID 177158602
8-propyl-3,4-dihydroquinoline (PubChem CID 177158602) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 8-propyl-3,4-dihydroquinoline.
| Compound Name | 8-propyl-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 177158602 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 8-propyl-3,4-dihydroquinoline |
| SMILES | CCCc1cccc2c1N=CCC2 |
| InChI | InChI=1S/C12H15N/c1-2-5-10-6-3-7-11-8-4-9-13-12(10)11/h3,6-7,9H,2,4-5,8H2,1H3 |
| InChIKey | OYFLBZUQOGUROE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |