C19H22 — CID 142524168
4-(2-methyl-3-propylphenyl)-2,3-dihydro-1H-indene (PubChem CID 142524168) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-(2-methyl-3-propylphenyl)-2,3-dihydro-1H-indene.
| Compound Name | 4-(2-methyl-3-propylphenyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 142524168 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-(2-methyl-3-propylphenyl)-2,3-dihydro-1H-indene |
| SMILES | CCCc1cccc(-c2cccc3c2CCC3)c1C |
| InChI | InChI=1S/C19H22/c1-3-7-15-8-4-11-17(14(15)2)19-13-6-10-16-9-5-12-18(16)19/h4,6,8,10-11,13H,3,5,7,9,12H2,1-2H3 |
| InChIKey | ADGAUKYZFMQDCD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |