C22H22N4 — CID 146453462
3,6-bis(5,6,7,8-tetrahydronaphthalen-1-yl)-1,2,4,5-tetrazine (PubChem CID 146453462) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 3,6-bis(5,6,7,8-tetrahydronaphthalen-1-yl)-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(5,6,7,8-tetrahydronaphthalen-1-yl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 146453462 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3,6-bis(5,6,7,8-tetrahydronaphthalen-1-yl)-1,2,4,5-tetrazine |
| SMILES | c1cc2c(c(-c3nnc(-c4cccc5c4CCCC5)nn3)c1)CCCC2 |
| InChI | InChI=1S/C22H22N4/c1-3-11-17-15(7-1)9-5-13-19(17)21-23-25-22(26-24-21)20-14-6-10-16-8-2-4-12-18(16)20/h5-6,9-10,13-14H,1-4,7-8,11-12H2 |
| InChIKey | PPONUVKFZZAOSV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |