C15H14FN — CID 140732685
2-fluoro-6-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridine (PubChem CID 140732685) has the molecular formula C15H14FN and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-fluoro-6-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridine.
| Compound Name | 2-fluoro-6-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridine |
|---|---|
| PubChem CID | 140732685 |
| Molecular Formula | C15H14FN |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-fluoro-6-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridine |
| SMILES | Fc1cccc(-c2cccc3c2CCCC3)n1 |
| InChI | InChI=1S/C15H14FN/c16-15-10-4-9-14(17-15)13-8-3-6-11-5-1-2-7-12(11)13/h3-4,6,8-10H,1-2,5,7H2 |
| InChIKey | KOTQWPBTOUGOSB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|