C14H16N4O — CID 138056287
2-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)triazol-1-yl]acetamide (PubChem CID 138056287) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)triazol-1-yl]acetamide.
| Compound Name | 2-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 138056287 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)triazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(-c2cccc3c2CCCC3)nn1 |
| InChI | InChI=1S/C14H16N4O/c15-14(19)9-18-8-13(16-17-18)12-7-3-5-10-4-1-2-6-11(10)12/h3,5,7-8H,1-2,4,6,9H2,(H2,15,19) |
| InChIKey | ZAKZZACIFJWOKR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |