C20H25O4P — CID 23110735
phosphoric acid;5-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 23110735) has the molecular formula C20H25O4P and a molecular weight of 360.39 g/mol. Its IUPAC name is phosphoric acid;5-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | phosphoric acid;5-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 23110735 |
| Molecular Formula | C20H25O4P |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | phosphoric acid;5-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=P(O)(O)O.c1cc2c(c(-c3cccc4c3CCCC4)c1)CCCC2 |
| InChI | InChI=1S/C20H22.H3O4P/c1-3-11-17-15(7-1)9-5-13-19(17)20-14-6-10-16-8-2-4-12-18(16)20;1-5(2,3)4/h5-6,9-10,13-14H,1-4,7-8,11-12H2;(H3,1,2,3,4) |
| InChIKey | YAGJLKNYVXLAOC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|