About N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide
N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide (PubChem CID 126997874) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide |
| PubChem CID | 126997874 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide |
| SMILES | O=C(NO)c1cccc2c1CCC2 |
| InChI | InChI=1S/C10H11NO2/c12-10(11-13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,13H,1,3,5H2,(H,11,12) |
| InChIKey | YZAHJGLWIDZNFA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide?
The IUPAC name of N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide (CID 126997874) is N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide.
What is the SMILES notation for N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide?
The canonical SMILES for N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide is O=C(NO)c1cccc2c1CCC2.
What is the InChIKey of N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide?
The InChIKey is YZAHJGLWIDZNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c12-10(11-13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,13H,1,3,5H2,(H,11,12).
What are the key properties of N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide?
N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide has a molecular weight of 177.20 g/mol, XLogP of 1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2,3-dihydro-1H-indene-4-carboxamide is sourced from PubChem (CID 126997874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).